C24H15F4N3O4S — CID 17315615
N-[3-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17315615) has the molecular formula C24H15F4N3O4S and a molecular weight of 517.46 g/mol. Its IUPAC name is N-[3-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17315615 |
| Molecular Formula | C24H15F4N3O4S |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | N-[3-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2cccc(NC(=O)c3cc4ccccc4o3)c2)c(F)c1F |
| InChI | InChI=1S/C24H15F4N3O4S/c1-34-21-19(27)17(25)16(18(26)20(21)28)23(33)31-24(36)30-13-7-4-6-12(10-13)29-22(32)15-9-11-5-2-3-8-14(11)35-15/h2-10H,1H3,(H,29,32)(H2,30,31,33,36) |
| InChIKey | PMVBREBAUGGEEZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|