C17H11F3N2O2S2 — CID 21041833
N-[[3-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 21041833) has the molecular formula C17H11F3N2O2S2 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[[3-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[3-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21041833 |
| Molecular Formula | C17H11F3N2O2S2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-[[3-(trifluoromethylsulfanyl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(SC(F)(F)F)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H11F3N2O2S2/c18-17(19,20)26-12-6-3-5-11(9-12)21-16(25)22-15(23)14-8-10-4-1-2-7-13(10)24-14/h1-9H,(H2,21,22,23,25) |
| InChIKey | MZEFQHBPUXYCNF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|