C19H16N4O3S2 — CID 3718880
N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 3718880) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3718880 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H16N4O3S2/c1-11(24)20-18(27)21-13-6-8-14(9-7-13)22-19(28)23-17(25)16-10-12-4-2-3-5-15(12)26-16/h2-10H,1H3,(H2,20,21,24,27)(H2,22,23,25,28) |
| InChIKey | ONCRGIVURLIUDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|