C23H22N2O4S — CID 17128797
cyclohexyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate (PubChem CID 17128797) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is cyclohexyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate.
| Compound Name | cyclohexyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 17128797 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | cyclohexyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate |
| SMILES | O=C(OC1CCCCC1)c1ccc(NC(=S)NC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c26-21(20-14-16-6-4-5-9-19(16)29-20)25-23(30)24-17-12-10-15(11-13-17)22(27)28-18-7-2-1-3-8-18/h4-6,9-14,18H,1-3,7-8H2,(H2,24,25,26,30) |
| InChIKey | YKKSBHXGHQUSGP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|