C21H20N2O4S — CID 2292185
butyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate (PubChem CID 2292185) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is butyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate.
| Compound Name | butyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 2292185 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | butyl 4-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=S)NC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-2-3-12-26-20(25)14-8-10-16(11-9-14)22-21(28)23-19(24)18-13-15-6-4-5-7-17(15)27-18/h4-11,13H,2-3,12H2,1H3,(H2,22,23,24,28) |
| InChIKey | SAOLGSHCAMOQOU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|