C23H16N2O4S — CID 21041865
phenyl 3-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate (PubChem CID 21041865) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is phenyl 3-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate.
| Compound Name | phenyl 3-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 21041865 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | phenyl 3-(1-benzofuran-2-carbonylcarbamothioylamino)benzoate |
| SMILES | O=C(Oc1ccccc1)c1cccc(NC(=S)NC(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C23H16N2O4S/c26-21(20-14-15-7-4-5-12-19(15)29-20)25-23(30)24-17-9-6-8-16(13-17)22(27)28-18-10-2-1-3-11-18/h1-14H,(H2,24,25,26,30) |
| InChIKey | CBNVOMICTOYMOO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|