C22H22FN3O2S — CID 59786830
N-[[3-fluoro-4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 59786830) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[3-fluoro-4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 59786830 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[[3-fluoro-4-(2-methylpiperidin-1-yl)phenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | CC1CCCCN1c1ccc(NC(=S)NC(=O)c2cc3ccccc3o2)cc1F |
| InChI | InChI=1S/C22H22FN3O2S/c1-14-6-4-5-11-26(14)18-10-9-16(13-17(18)23)24-22(29)25-21(27)20-12-15-7-2-3-8-19(15)28-20/h2-3,7-10,12-14H,4-6,11H2,1H3,(H2,24,25,27,29) |
| InChIKey | VGJYDZLYNRHEOI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|