C23H15N3O3S — CID 1340360
N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 1340360) has the molecular formula C23H15N3O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1340360 |
| Molecular Formula | C23H15N3O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccccc3)nc2c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H15N3O3S/c27-21(20-12-15-8-4-5-9-18(15)28-20)26-23(30)24-16-10-11-19-17(13-16)25-22(29-19)14-6-2-1-3-7-14/h1-13H,(H2,24,26,27,30) |
| InChIKey | SQOJVQBJZSBWQJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|