C23H14ClN3O3S — CID 4260996
N-[[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 4260996) has the molecular formula C23H14ClN3O3S and a molecular weight of 447.90 g/mol. Its IUPAC name is N-[[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4260996 |
| Molecular Formula | C23H14ClN3O3S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | N-[[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3o2)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H14ClN3O3S/c24-16-10-9-14(12-15(16)22-26-17-6-2-4-8-19(17)30-22)25-23(31)27-21(28)20-11-13-5-1-3-7-18(13)29-20/h1-12H,(H2,25,27,28,31) |
| InChIKey | HGNVXULVNPLIML-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|