C14H10ClN3OS — CID 50880019
[3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]thiourea (PubChem CID 50880019) has the molecular formula C14H10ClN3OS and a molecular weight of 303.77 g/mol. Its IUPAC name is [3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]thiourea.
| Compound Name | [3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]thiourea |
|---|---|
| PubChem CID | 50880019 |
| Molecular Formula | C14H10ClN3OS |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | [3-(1,3-benzoxazol-2-yl)-4-chlorophenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C14H10ClN3OS/c15-10-6-5-8(17-14(16)20)7-9(10)13-18-11-3-1-2-4-12(11)19-13/h1-7H,(H3,16,17,20) |
| InChIKey | BZESXQWHUYJUCO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|