C13H8ClNO — CID 3014177
2-(2-chlorophenyl)-1,3-benzoxazole (PubChem CID 3014177) has the molecular formula C13H8ClNO and a molecular weight of 229.67 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1,3-benzoxazole.
| Compound Name | 2-(2-chlorophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 3014177 |
| Molecular Formula | C13H8ClNO |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-(2-chlorophenyl)-1,3-benzoxazole |
| SMILES | Clc1ccccc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H8ClNO/c14-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8H |
| InChIKey | XFITVKFDHMNKSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |