C26H18ClN4O3P — CID 25112701
2-(1,3-benzoxazol-2-yl)-N-[[2-(1,3-benzoxazol-2-yl)anilino]-chlorophosphoryl]aniline (PubChem CID 25112701) has the molecular formula C26H18ClN4O3P and a molecular weight of 500.88 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-N-[[2-(1,3-benzoxazol-2-yl)anilino]-chlorophosphoryl]aniline.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-N-[[2-(1,3-benzoxazol-2-yl)anilino]-chlorophosphoryl]aniline |
|---|---|
| PubChem CID | 25112701 |
| Molecular Formula | C26H18ClN4O3P |
| Molecular Weight | 500.88 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-N-[[2-(1,3-benzoxazol-2-yl)anilino]-chlorophosphoryl]aniline |
| SMILES | O=P(Cl)(Nc1ccccc1-c1nc2ccccc2o1)Nc1ccccc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C26H18ClN4O3P/c27-35(32,30-19-11-3-1-9-17(19)25-28-21-13-5-7-15-23(21)33-25)31-20-12-4-2-10-18(20)26-29-22-14-6-8-16-24(22)34-26/h1-16H,(H2,30,31,32) |
| InChIKey | YLVHYDQSRGPLKL-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.88 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|