C13H8N3OZn- — CID 155109070
[2-(1,3-benzoxazol-2-yl)phenyl]iminoazanide;zinc (PubChem CID 155109070) has the molecular formula C13H8N3OZn- and a molecular weight of 287.62 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)phenyl]iminoazanide;zinc.
| Compound Name | [2-(1,3-benzoxazol-2-yl)phenyl]iminoazanide;zinc |
|---|---|
| PubChem CID | 155109070 |
| Molecular Formula | C13H8N3OZn- |
| Molecular Weight | 287.62 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)phenyl]iminoazanide;zinc |
| SMILES | [N-]=Nc1ccccc1-c1nc2ccccc2o1.[Zn] |
| InChI | InChI=1S/C13H8N3O.Zn/c14-16-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)17-13;/h1-8H;/q-1; |
| InChIKey | AFXKDAIOFMBOGK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 60.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|