C26H18N2O4Yb — CID 157356181
bis(2-(1,3-benzoxazol-2-yl)phenol);ytterbium (PubChem CID 157356181) has the molecular formula C26H18N2O4Yb and a molecular weight of 595.48 g/mol. Its IUPAC name is bis(2-(1,3-benzoxazol-2-yl)phenol);ytterbium.
| Compound Name | bis(2-(1,3-benzoxazol-2-yl)phenol);ytterbium |
|---|---|
| PubChem CID | 157356181 |
| Molecular Formula | C26H18N2O4Yb |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 596.07 |
| IUPAC Name | bis(2-(1,3-benzoxazol-2-yl)phenol);ytterbium |
| SMILES | Oc1ccccc1-c1nc2ccccc2o1.Oc1ccccc1-c1nc2ccccc2o1.[Yb] |
| InChI | InChI=1S/2C13H9NO2.Yb/c2*15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h2*1-8,15H; |
| InChIKey | CGUXPTUGUPPQKH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |