C13H6F3NO — CID 22625179
2-(2,3,4-trifluorophenyl)-1,3-benzoxazole (PubChem CID 22625179) has the molecular formula C13H6F3NO and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenyl)-1,3-benzoxazole.
| Compound Name | 2-(2,3,4-trifluorophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 22625179 |
| Molecular Formula | C13H6F3NO |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-(2,3,4-trifluorophenyl)-1,3-benzoxazole |
| SMILES | Fc1ccc(-c2nc3ccccc3o2)c(F)c1F |
| InChI | InChI=1S/C13H6F3NO/c14-8-6-5-7(11(15)12(8)16)13-17-9-3-1-2-4-10(9)18-13/h1-6H |
| InChIKey | HEYVXRYVTRHXSL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|