C13H6F4N2O — CID 11129738
4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluoroaniline (PubChem CID 11129738) has the molecular formula C13H6F4N2O and a molecular weight of 282.20 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluoroaniline.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 11129738 |
| Molecular Formula | C13H6F4N2O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2,3,5,6-tetrafluoroaniline |
| SMILES | Nc1c(F)c(F)c(-c2nc3ccccc3o2)c(F)c1F |
| InChI | InChI=1S/C13H6F4N2O/c14-8-7(9(15)11(17)12(18)10(8)16)13-19-5-3-1-2-4-6(5)20-13/h1-4H,18H2 |
| InChIKey | GJOBOVOOONQSIB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|