C16H11F3N2O3 — CID 102373392
N-[2-(1,3-benzoxazol-2-yl)-3,4,6-trifluoro-5-methoxyphenyl]acetamide (PubChem CID 102373392) has the molecular formula C16H11F3N2O3 and a molecular weight of 336.27 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yl)-3,4,6-trifluoro-5-methoxyphenyl]acetamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-yl)-3,4,6-trifluoro-5-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 102373392 |
| Molecular Formula | C16H11F3N2O3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yl)-3,4,6-trifluoro-5-methoxyphenyl]acetamide |
| SMILES | COc1c(F)c(F)c(-c2nc3ccccc3o2)c(NC(C)=O)c1F |
| InChI | InChI=1S/C16H11F3N2O3/c1-7(22)20-14-10(11(17)12(18)15(23-2)13(14)19)16-21-8-5-3-4-6-9(8)24-16/h3-6H,1-2H3,(H,20,22) |
| InChIKey | APAIULQIPYPTJU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|