C23H13BrF5N3O3S — CID 4269409
5-bromo-2-methoxy-3-methyl-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 4269409) has the molecular formula C23H13BrF5N3O3S and a molecular weight of 586.34 g/mol. Its IUPAC name is 5-bromo-2-methoxy-3-methyl-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-3-methyl-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4269409 |
| Molecular Formula | C23H13BrF5N3O3S |
| Molecular Weight | 586.34 g/mol |
| Exact Mass | 584.98 |
| IUPAC Name | 5-bromo-2-methoxy-3-methyl-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)NC(=S)Nc1ccc2oc(-c3c(F)c(F)c(F)c(F)c3F)nc2c1 |
| InChI | InChI=1S/C23H13BrF5N3O3S/c1-8-5-9(24)6-11(20(8)34-2)21(33)32-23(36)30-10-3-4-13-12(7-10)31-22(35-13)14-15(25)17(27)19(29)18(28)16(14)26/h3-7H,1-2H3,(H2,30,32,33,36) |
| InChIKey | PYZMCEPNIQRLHM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.34 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|