C24H19BrClN3O3S — CID 3499219
5-bromo-N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 3499219) has the molecular formula C24H19BrClN3O3S and a molecular weight of 544.86 g/mol. Its IUPAC name is 5-bromo-N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | 5-bromo-N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 3499219 |
| Molecular Formula | C24H19BrClN3O3S |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 543.00 |
| IUPAC Name | 5-bromo-N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)NC(=S)Nc1ccc2oc(-c3ccc(C)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C24H19BrClN3O3S/c1-12-4-5-14(9-18(12)26)23-28-19-11-16(6-7-20(19)32-23)27-24(33)29-22(30)17-10-15(25)8-13(2)21(17)31-3/h4-11H,1-3H3,(H2,27,29,30,33) |
| InChIKey | XHDTXYLIINLQLH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|