C23H16BrCl2N3O3S — CID 3417266
5-bromo-N-[[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 3417266) has the molecular formula C23H16BrCl2N3O3S and a molecular weight of 565.28 g/mol. Its IUPAC name is 5-bromo-N-[[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | 5-bromo-N-[[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 3417266 |
| Molecular Formula | C23H16BrCl2N3O3S |
| Molecular Weight | 565.28 g/mol |
| Exact Mass | 562.95 |
| IUPAC Name | 5-bromo-N-[[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)NC(=S)Nc1ccc2oc(-c3cc(Cl)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C23H16BrCl2N3O3S/c1-11-7-12(24)8-16(20(11)31-2)21(30)29-23(33)27-14-4-6-19-18(10-14)28-22(32-19)15-9-13(25)3-5-17(15)26/h3-10H,1-2H3,(H2,27,29,30,33) |
| InChIKey | DWZGINQGGWEUSL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.28 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|