C24H19BrClN3O2S — CID 17127669
5-bromo-2-chloro-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 17127669) has the molecular formula C24H19BrClN3O2S and a molecular weight of 528.86 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17127669 |
| Molecular Formula | C24H19BrClN3O2S |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | 5-bromo-2-chloro-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | CC(C)c1ccc(-c2nc3cc(NC(=S)NC(=O)c4cc(Br)ccc4Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C24H19BrClN3O2S/c1-13(2)14-3-5-15(6-4-14)23-28-20-12-17(8-10-21(20)31-23)27-24(32)29-22(30)18-11-16(25)7-9-19(18)26/h3-13H,1-2H3,(H2,27,29,30,32) |
| InChIKey | NVRIFCFIWYQRCS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|