C23H17BrClN3O4S — CID 17128584
5-bromo-2-chloro-N-[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 17128584) has the molecular formula C23H17BrClN3O4S and a molecular weight of 546.83 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17128584 |
| Molecular Formula | C23H17BrClN3O4S |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 544.98 |
| IUPAC Name | 5-bromo-2-chloro-N-[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=S)NC(=O)c4cc(Br)ccc4Cl)ccc3o2)cc1OC |
| InChI | InChI=1S/C23H17BrClN3O4S/c1-30-19-7-3-12(9-20(19)31-2)22-27-17-11-14(5-8-18(17)32-22)26-23(33)28-21(29)15-10-13(24)4-6-16(15)25/h3-11H,1-2H3,(H2,26,28,29,33) |
| InChIKey | CRZBWFBCVKQVQH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|