C25H23N3O3S — CID 17127670
2-methoxy-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 17127670) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-methoxy-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 2-methoxy-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17127670 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-methoxy-N-[[2-(4-propan-2-ylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | COc1ccccc1C(=O)NC(=S)Nc1ccc2oc(-c3ccc(C(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C25H23N3O3S/c1-15(2)16-8-10-17(11-9-16)24-27-20-14-18(12-13-22(20)31-24)26-25(32)28-23(29)19-6-4-5-7-21(19)30-3/h4-15H,1-3H3,(H2,26,28,29,32) |
| InChIKey | RJEONCFYSRTECJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|