C27H21N3O3S — CID 2217577
3-methoxy-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 2217577) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is 3-methoxy-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 2217577 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 3-methoxy-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NC(=S)Nc1ccc(-c2nc3cc(C)ccc3o2)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c1-16-7-12-23-22(13-16)29-26(33-23)17-8-10-20(11-9-17)28-27(34)30-25(31)21-14-18-5-3-4-6-19(18)15-24(21)32-2/h3-15H,1-2H3,(H2,28,30,31,34) |
| InChIKey | QDTCJXJSLUVLGO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|