C24H21N3O4S — CID 1259106
2,6-dimethoxy-N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 1259106) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1259106 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2,6-dimethoxy-N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1cccc(-c2nc3cc(C)ccc3o2)c1 |
| InChI | InChI=1S/C24H21N3O4S/c1-14-10-11-18-17(12-14)26-23(31-18)15-6-4-7-16(13-15)25-24(32)27-22(28)21-19(29-2)8-5-9-20(21)30-3/h4-13H,1-3H3,(H2,25,27,28,32) |
| InChIKey | FUKKQMNVKAVYPO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|