C22H16N4O5S — CID 17104372
N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-nitrobenzamide (PubChem CID 17104372) has the molecular formula C22H16N4O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 17104372 |
| Molecular Formula | C22H16N4O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-nitrobenzamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=S)NC(=O)c4ccccc4[N+](=O)[O-])cc3)nc2c1 |
| InChI | InChI=1S/C22H16N4O5S/c1-30-15-10-11-19-17(12-15)24-21(31-19)13-6-8-14(9-7-13)23-22(32)25-20(27)16-4-2-3-5-18(16)26(28)29/h2-12H,1H3,(H2,23,25,27,32) |
| InChIKey | OSDLCFGQMVQWFU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|