C26H23N5O6S — CID 21168552
N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 21168552) has the molecular formula C26H23N5O6S and a molecular weight of 533.57 g/mol. Its IUPAC name is N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 21168552 |
| Molecular Formula | C26H23N5O6S |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=S)NC(=O)c4cc([N+](=O)[O-])ccc4N4CCOCC4)cc3)nc2c1 |
| InChI | InChI=1S/C26H23N5O6S/c1-35-19-7-9-23-21(15-19)28-25(37-23)16-2-4-17(5-3-16)27-26(38)29-24(32)20-14-18(31(33)34)6-8-22(20)30-10-12-36-13-11-30/h2-9,14-15H,10-13H2,1H3,(H2,27,29,32,38) |
| InChIKey | QSDFBNWWUWITHJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|