C34H26N6O5S — CID 17333931
2-morpholin-4-yl-5-nitro-N-[[2-(3-phenylquinolin-4-yl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 17333931) has the molecular formula C34H26N6O5S and a molecular weight of 630.69 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-nitro-N-[[2-(3-phenylquinolin-4-yl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 2-morpholin-4-yl-5-nitro-N-[[2-(3-phenylquinolin-4-yl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17333931 |
| Molecular Formula | C34H26N6O5S |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | 2-morpholin-4-yl-5-nitro-N-[[2-(3-phenylquinolin-4-yl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3c(-c4ccccc4)cnc4ccccc34)nc2c1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C34H26N6O5S/c41-32(25-19-23(40(42)43)11-12-29(25)39-14-16-44-17-15-39)38-34(46)36-22-10-13-30-28(18-22)37-33(45-30)31-24-8-4-5-9-27(24)35-20-26(31)21-6-2-1-3-7-21/h1-13,18-20H,14-17H2,(H2,36,38,41,46) |
| InChIKey | HRLAVGSOOVDMIL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|