C28H26ClN5O5S — CID 21170896
N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 21170896) has the molecular formula C28H26ClN5O5S and a molecular weight of 580.07 g/mol. Its IUPAC name is N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 21170896 |
| Molecular Formula | C28H26ClN5O5S |
| Molecular Weight | 580.07 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | N-[[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CC(C)c1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4cc([N+](=O)[O-])ccc4N4CCOCC4)c3)nc2c1 |
| InChI | InChI=1S/C28H26ClN5O5S/c1-16(2)17-4-8-25-23(13-17)30-27(39-25)18-3-6-21(29)22(14-18)31-28(40)32-26(35)20-15-19(34(36)37)5-7-24(20)33-9-11-38-12-10-33/h3-8,13-16H,9-12H2,1-2H3,(H2,31,32,35,40) |
| InChIKey | HUZDKFRAUPOQDN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.07 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|