C25H21ClN4O4S — CID 4636704
N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-chloro-5-nitrobenzamide (PubChem CID 4636704) has the molecular formula C25H21ClN4O4S and a molecular weight of 508.99 g/mol. Its IUPAC name is N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-chloro-5-nitrobenzamide.
| Compound Name | N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 4636704 |
| Molecular Formula | C25H21ClN4O4S |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-2-chloro-5-nitrobenzamide |
| SMILES | CCC(C)c1ccc2oc(-c3cccc(NC(=S)NC(=O)c4cc([N+](=O)[O-])ccc4Cl)c3)nc2c1 |
| InChI | InChI=1S/C25H21ClN4O4S/c1-3-14(2)15-7-10-22-21(12-15)28-24(34-22)16-5-4-6-17(11-16)27-25(35)29-23(31)19-13-18(30(32)33)8-9-20(19)26/h4-14H,3H2,1-2H3,(H2,27,29,31,35) |
| InChIKey | QFZBVUXYYXJFST-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|