C29H24ClN3O2S — CID 26020121
N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-5-chloronaphthalene-1-carboxamide (PubChem CID 26020121) has the molecular formula C29H24ClN3O2S and a molecular weight of 514.05 g/mol. Its IUPAC name is N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-5-chloronaphthalene-1-carboxamide.
| Compound Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-5-chloronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 26020121 |
| Molecular Formula | C29H24ClN3O2S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-5-chloronaphthalene-1-carboxamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)c4cccc5c(Cl)cccc45)cc3)nc2c1 |
| InChI | InChI=1S/C29H24ClN3O2S/c1-3-17(2)19-12-15-26-25(16-19)32-28(35-26)18-10-13-20(14-11-18)31-29(36)33-27(34)23-8-4-7-22-21(23)6-5-9-24(22)30/h4-17H,3H2,1-2H3,(H2,31,33,34,36)/t17-/m0/s1 |
| InChIKey | AJFVUNOZUZPJOZ-KRWDZBQOSA-N |
| XLogP | 7.94 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|