C27H22ClN3O2S2 — CID 40871284
N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 40871284) has the molecular formula C27H22ClN3O2S2 and a molecular weight of 520.08 g/mol. Its IUPAC name is N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 40871284 |
| Molecular Formula | C27H22ClN3O2S2 |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)c4sc5ccccc5c4Cl)cc3)nc2c1 |
| InChI | InChI=1S/C27H22ClN3O2S2/c1-3-15(2)17-10-13-21-20(14-17)30-26(33-21)16-8-11-18(12-9-16)29-27(34)31-25(32)24-23(28)19-6-4-5-7-22(19)35-24/h4-15H,3H2,1-2H3,(H2,29,31,32,34)/t15-/m0/s1 |
| InChIKey | RTBGEGLWYWNAAB-HNNXBMFYSA-N |
| XLogP | 8.00 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|