C27H25N3O2S — CID 28842402
(E)-N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 28842402) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is (E)-N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 28842402 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (E)-N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)/C=C/c4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C27H25N3O2S/c1-3-18(2)21-12-15-24-23(17-21)29-26(32-24)20-10-13-22(14-11-20)28-27(33)30-25(31)16-9-19-7-5-4-6-8-19/h4-18H,3H2,1-2H3,(H2,28,30,31,33)/b16-9+/t18-/m0/s1 |
| InChIKey | ZLCUENMCNIRRLL-WBNHJWIASA-N |
| XLogP | 6.53 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|