C30H31N3O2S — CID 6169879
(E)-N-[[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 6169879) has the molecular formula C30H31N3O2S and a molecular weight of 497.66 g/mol. Its IUPAC name is (E)-N-[[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6169879 |
| Molecular Formula | C30H31N3O2S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (E)-N-[[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)/C=C/c4ccc(C(C)C)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C30H31N3O2S/c1-5-20(4)24-13-16-27-26(18-24)32-29(35-27)23-11-14-25(15-12-23)31-30(36)33-28(34)17-8-21-6-9-22(10-7-21)19(2)3/h6-20H,5H2,1-4H3,(H2,31,33,34,36)/b17-8+ |
| InChIKey | LWEBXBGIYJVFIR-CAOOACKPSA-N |
| XLogP | 7.66 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|