C27H24ClN3O2S — CID 28873736
(E)-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 28873736) has the molecular formula C27H24ClN3O2S and a molecular weight of 490.03 g/mol. Its IUPAC name is (E)-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28873736 |
| Molecular Formula | C27H24ClN3O2S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (E)-N-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)/C=C/c4ccc(Cl)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C27H24ClN3O2S/c1-3-17(2)20-9-14-24-23(16-20)30-26(33-24)19-7-12-22(13-8-19)29-27(34)31-25(32)15-6-18-4-10-21(28)11-5-18/h4-17H,3H2,1-2H3,(H2,29,31,32,34)/b15-6+/t17-/m1/s1 |
| InChIKey | DMCJNJDMUNXPST-GFGNLIMNSA-N |
| XLogP | 7.19 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|