C27H27N3O3S — CID 28842424
N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide (PubChem CID 28842424) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 28842424 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)COc4ccccc4C)cc3)nc2c1 |
| InChI | InChI=1S/C27H27N3O3S/c1-4-17(2)20-11-14-24-22(15-20)29-26(33-24)19-9-12-21(13-10-19)28-27(34)30-25(31)16-32-23-8-6-5-7-18(23)3/h5-15,17H,4,16H2,1-3H3,(H2,28,30,31,34)/t17-/m0/s1 |
| InChIKey | YOSQFPKMUZIDTK-KRWDZBQOSA-N |
| XLogP | 6.21 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|