C26H22ClN3O4 — CID 27235882
(E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide (PubChem CID 27235882) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is (E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27235882 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (E)-N-[3-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3cccc(NC(=O)/C=C/c4ccc(Cl)c([N+](=O)[O-])c4)c3)nc2c1 |
| InChI | InChI=1S/C26H22ClN3O4/c1-3-16(2)18-9-11-24-22(15-18)29-26(34-24)19-5-4-6-20(14-19)28-25(31)12-8-17-7-10-21(27)23(13-17)30(32)33/h4-16H,3H2,1-2H3,(H,28,31)/b12-8+/t16-/m1/s1 |
| InChIKey | SKUKAWHPQUKDFE-OQRGYWNNSA-N |
| XLogP | 7.22 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|