C23H16ClN3O5 — CID 1327717
(E)-3-(4-chloro-3-nitrophenyl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 1327717) has the molecular formula C23H16ClN3O5 and a molecular weight of 449.85 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1327717 |
| Molecular Formula | C23H16ClN3O5 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)/C=C/c4ccc(Cl)c([N+](=O)[O-])c4)ccc3o2)cc1 |
| InChI | InChI=1S/C23H16ClN3O5/c1-31-17-7-4-15(5-8-17)23-26-19-13-16(6-10-21(19)32-23)25-22(28)11-3-14-2-9-18(24)20(12-14)27(29)30/h2-13H,1H3,(H,25,28)/b11-3+ |
| InChIKey | NVANABHHQAPSLG-QDEBKDIKSA-N |
| XLogP | 5.72 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|