C23H17BrN2O3 — CID 3125082
N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 3125082) has the molecular formula C23H17BrN2O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3125082 |
| Molecular Formula | C23H17BrN2O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc3oc(-c4ccc(Br)cc4)nc3c2)cc1 |
| InChI | InChI=1S/C23H17BrN2O3/c1-28-19-10-2-15(3-11-19)4-13-22(27)25-18-9-12-21-20(14-18)26-23(29-21)16-5-7-17(24)8-6-16/h2-14H,1H3,(H,25,27) |
| InChIKey | HXERKKNQAPBTKP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|