C27H26BrN3O3 — CID 21167435
(E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 21167435) has the molecular formula C27H26BrN3O3 and a molecular weight of 520.43 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21167435 |
| Molecular Formula | C27H26BrN3O3 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(NC(=O)/C=C/c4cc(Br)ccc4OC)ccc3o2)cc1 |
| InChI | InChI=1S/C27H26BrN3O3/c1-4-31(5-2)22-11-6-18(7-12-22)27-30-23-17-21(10-14-25(23)34-27)29-26(32)15-8-19-16-20(28)9-13-24(19)33-3/h6-17H,4-5H2,1-3H3,(H,29,32)/b15-8+ |
| InChIKey | JZNZOKAQLMDVFM-OVCLIPMQSA-N |
| XLogP | 6.76 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|