C22H27N3O2 — CID 21229547
N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]pentanamide (PubChem CID 21229547) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]pentanamide.
| Compound Name | N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 21229547 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc2oc(-c3ccc(N(CC)CC)cc3)nc2c1 |
| InChI | InChI=1S/C22H27N3O2/c1-4-7-8-21(26)23-17-11-14-20-19(15-17)24-22(27-20)16-9-12-18(13-10-16)25(5-2)6-3/h9-15H,4-8H2,1-3H3,(H,23,26) |
| InChIKey | WRDCZMIPJKIDSM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|