C26H24Br2N4O3S — CID 21172166
3,5-dibromo-N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxybenzamide (PubChem CID 21172166) has the molecular formula C26H24Br2N4O3S and a molecular weight of 632.38 g/mol. Its IUPAC name is 3,5-dibromo-N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 21172166 |
| Molecular Formula | C26H24Br2N4O3S |
| Molecular Weight | 632.38 g/mol |
| Exact Mass | 629.99 |
| IUPAC Name | 3,5-dibromo-N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(NC(=S)NC(=O)c4cc(Br)cc(Br)c4OC)ccc3o2)cc1 |
| InChI | InChI=1S/C26H24Br2N4O3S/c1-4-32(5-2)18-9-6-15(7-10-18)25-30-21-14-17(8-11-22(21)35-25)29-26(36)31-24(33)19-12-16(27)13-20(28)23(19)34-3/h6-14H,4-5H2,1-3H3,(H2,29,31,33,36) |
| InChIKey | XFNLCQQUWURBOI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.38 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|