C26H23Br2N3O3S — CID 17314622
3,5-dibromo-2-methoxy-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide (PubChem CID 17314622) has the molecular formula C26H23Br2N3O3S and a molecular weight of 617.36 g/mol. Its IUPAC name is 3,5-dibromo-2-methoxy-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide.
| Compound Name | 3,5-dibromo-2-methoxy-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 17314622 |
| Molecular Formula | C26H23Br2N3O3S |
| Molecular Weight | 617.36 g/mol |
| Exact Mass | 614.98 |
| IUPAC Name | 3,5-dibromo-2-methoxy-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)NC(=S)NCc1ccc(-c2nc3cc(C(C)C)ccc3o2)cc1 |
| InChI | InChI=1S/C26H23Br2N3O3S/c1-14(2)17-8-9-22-21(10-17)30-25(34-22)16-6-4-15(5-7-16)13-29-26(35)31-24(32)19-11-18(27)12-20(28)23(19)33-3/h4-12,14H,13H2,1-3H3,(H2,29,31,32,35) |
| InChIKey | DHYAKVLMVGAGEL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.36 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|