C31H29N3O3S — CID 3558241
5-(3,4-dimethylphenyl)-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide (PubChem CID 3558241) has the molecular formula C31H29N3O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3558241 |
| Molecular Formula | C31H29N3O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)NCc3ccc(-c4nc5cc(C(C)C)ccc5o4)cc3)o2)cc1C |
| InChI | InChI=1S/C31H29N3O3S/c1-18(2)23-11-12-27-25(16-23)33-30(37-27)22-9-6-21(7-10-22)17-32-31(38)34-29(35)28-14-13-26(36-28)24-8-5-19(3)20(4)15-24/h5-16,18H,17H2,1-4H3,(H2,32,34,35,38) |
| InChIKey | AXBFRRMAFBYNKS-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|