C29H24ClN3O4S — CID 17316472
5-(3-chlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17316472) has the molecular formula C29H24ClN3O4S and a molecular weight of 546.05 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17316472 |
| Molecular Formula | C29H24ClN3O4S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | COc1ccc(-c2nc3cc(C(C)C)ccc3o2)cc1NC(=S)NC(=O)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C29H24ClN3O4S/c1-16(2)17-7-10-25-22(14-17)31-28(37-25)19-8-9-24(35-3)21(15-19)32-29(38)33-27(34)26-12-11-23(36-26)18-5-4-6-20(30)13-18/h4-16H,1-3H3,(H2,32,33,34,38) |
| InChIKey | NRGVSSSGTFHUOI-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|