C27H27N3O4S — CID 5108509
3-ethoxy-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 5108509) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 3-ethoxy-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-ethoxy-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5108509 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-ethoxy-N-[[2-methoxy-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2cc(-c3nc4cc(C(C)C)ccc4o3)ccc2OC)c1 |
| InChI | InChI=1S/C27H27N3O4S/c1-5-33-20-8-6-7-18(13-20)25(31)30-27(35)29-21-15-19(10-11-23(21)32-4)26-28-22-14-17(16(2)3)9-12-24(22)34-26/h6-16H,5H2,1-4H3,(H2,29,30,31,35) |
| InChIKey | UBUIBHDLPSHPBU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|