C28H29N3O5S — CID 3327489
N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3,5-diethoxybenzamide (PubChem CID 3327489) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3,5-diethoxybenzamide.
| Compound Name | N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3,5-diethoxybenzamide |
|---|---|
| PubChem CID | 3327489 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3,5-diethoxybenzamide |
| SMILES | CCOc1cc(OCC)cc(C(=O)NC(=S)Nc2cc(-c3nc4cc(C)c(C)cc4o3)ccc2OC)c1 |
| InChI | InChI=1S/C28H29N3O5S/c1-6-34-20-12-19(13-21(15-20)35-7-2)26(32)31-28(37)30-23-14-18(8-9-24(23)33-5)27-29-22-10-16(3)17(4)11-25(22)36-27/h8-15H,6-7H2,1-5H3,(H2,30,31,32,37) |
| InChIKey | OCGDVSKSYGHEQV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|