C25H22BrN3O4S — CID 3327484
3-bromo-N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 3327484) has the molecular formula C25H22BrN3O4S and a molecular weight of 540.44 g/mol. Its IUPAC name is 3-bromo-N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3327484 |
| Molecular Formula | C25H22BrN3O4S |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 3-bromo-N-[[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cc(-c3nc4cc(C)c(C)cc4o3)ccc2OC)cc1Br |
| InChI | InChI=1S/C25H22BrN3O4S/c1-13-9-18-22(10-14(13)2)33-24(27-18)16-6-8-21(32-4)19(12-16)28-25(34)29-23(30)15-5-7-20(31-3)17(26)11-15/h5-12H,1-4H3,(H2,28,29,30,34) |
| InChIKey | TWKAVPJUYSCNMO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|