C24H21N3O6 — CID 3321295
N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]-4-methoxy-3-nitrobenzamide (PubChem CID 3321295) has the molecular formula C24H21N3O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 3321295 |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methoxyphenyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(-c2nc3cc(C)c(C)cc3o2)cc1NC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N3O6/c1-13-9-17-22(10-14(13)2)33-24(26-17)16-6-7-20(31-3)18(11-16)25-23(28)15-5-8-21(32-4)19(12-15)27(29)30/h5-12H,1-4H3,(H,25,28) |
| InChIKey | ANWFMRPKRFZJHM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|