C21H14BrN3O6 — CID 3399143
N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide (PubChem CID 3399143) has the molecular formula C21H14BrN3O6 and a molecular weight of 484.26 g/mol. Its IUPAC name is N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 3399143 |
| Molecular Formula | C21H14BrN3O6 |
| Molecular Weight | 484.26 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3oc(-c4ccc(O)c(Br)c4)nc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14BrN3O6/c1-30-19-6-3-11(9-16(19)25(28)29)20(27)23-13-4-7-18-15(10-13)24-21(31-18)12-2-5-17(26)14(22)8-12/h2-10,26H,1H3,(H,23,27) |
| InChIKey | ZUBFVVNVFYRPMS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 127.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|